|
CAS#: 82439-10-9 Product: 1-Methyl-4-(3-Piperidinyl)-1H-Indole Monohydrochloride No suppilers available for the product. |
| Name | 1-Methyl-4-(3-Piperidinyl)-1H-Indole Monohydrochloride |
|---|---|
| Synonyms | 1-Methyl-4-(3-Piperidyl)Indole Hydrochloride; 1-Methyl-4-(3-Piperidinyl)Indole Hydrochloride; 1-Methyl-4-Piperidin-3-Yl-Indole Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C14H19ClN2 |
| Molecular Weight | 250.77 |
| CAS Registry Number | 82439-10-9 |
| SMILES | [H+].C1=C[N](C2=C1C(=CC=C2)C3CNCCC3)C.[Cl-] |
| InChI | 1S/C14H18N2.ClH/c1-16-9-7-13-12(5-2-6-14(13)16)11-4-3-8-15-10-11;/h2,5-7,9,11,15H,3-4,8,10H2,1H3;1H |
| InChIKey | DKHGGELIMLRNJA-UHFFFAOYSA-N |
| Boiling point | 382.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 185.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methyl-4-(3-Piperidinyl)-1H-Indole Monohydrochloride |