Online Database of Chemicals from Around the World
|
CAS#: 831170-94-6 Product: 5-(3-Buten-2-yloxy)-1,3-dimethoxy-2-methylbenzene No suppilers available for the product. |
| Name | 5-(3-Buten-2-yloxy)-1,3-dimethoxy-2-methylbenzene |
|---|---|
| Synonyms | 5-(3-Buten-2-yloxy)-1,3-dimethoxy-2-methylbenzene; 5-(3-Butén-2-yloxy)-1,3-diméthoxy-2-méthylbenzène; 5-(3-Buten-2-yloxy)-1,3-dimethoxy-2-methylbenzol |
| Molecular Structure |  |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 |
| CAS Registry Number | 831170-94-6 |
| SMILES | Cc1c(cc(cc1OC)OC(C)C=C)OC |
| InChI | 1S/C13H18O3/c1-6-9(2)16-11-7-12(14-4)10(3)13(8-11)15-5/h6-9H,1H2,2-5H3 |
| InChIKey | LBGIGGQMWMVEGX-UHFFFAOYSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 316.6±37.0°C at 760 mmHg (Cal.) |
| Flash point | 105.8±23.8°C (Cal.) |
| Refractive index | 1.493 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(3-Buten-2-yloxy)-1,3-dimethoxy-2-methylbenzene |