|
CAS#: 83846-53-1 Product: 7,9-Dimethylspiro[5.5]undeca-1,8-dien-3-one No suppilers available for the product. |
| Name | 7,9-Dimethylspiro[5.5]undeca-1,8-dien-3-one |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.28 |
| CAS Registry Number | 83846-53-1 |
| EINECS | 281-029-8 |
| SMILES | O=C\2CCC1(CCC(/C)=C\C1C)/C=C/2 |
| InChI | 1S/C13H18O/c1-10-3-6-13(11(2)9-10)7-4-12(14)5-8-13/h4,7,9,11H,3,5-6,8H2,1-2H3 |
| InChIKey | CZZDWTTUPHCLPO-UHFFFAOYSA-N |
| Density | 1g/cm3 (Cal.) |
|---|---|
| Boiling point | 304.827°C at 760 mmHg (Cal.) |
| Flash point | 128.855°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7,9-Dimethylspiro[5.5]undeca-1,8-dien-3-one |