|
CAS#: 84145-18-6 Product: 1,1,2,2,3,3-Hexafluoro-1-[(Trifluorovinyl)Oxy]Propane No suppilers available for the product. |
| Name | 1,1,2,2,3,3-Hexafluoro-1-[(Trifluorovinyl)Oxy]Propane |
|---|---|
| Synonyms | 1,1,2-Trifluoro-2-(1,1,2,2,3,3-Hexafluoropropoxy)Ethylene; 1,1,2,2,3,3-Hexafluoro-1-((Trifluorovinyl)Oxy)Propane |
| Molecular Structure | ![]() |
| Molecular Formula | C5HF9O |
| Molecular Weight | 248.05 |
| CAS Registry Number | 84145-18-6 |
| EINECS | 282-242-9 |
| SMILES | C(F)(F)=C(F)OC(F)(F)C(F)(F)C(F)F |
| InChI | 1S/C5HF9O/c6-1(7)2(8)15-5(13,14)4(11,12)3(9)10/h3H |
| InChIKey | ZCOLNYMULWIGPK-UHFFFAOYSA-N |
| Density | 1.549g/cm3 (Cal.) |
|---|---|
| Boiling point | 79.296°C at 760 mmHg (Cal.) |
| Flash point | 6.926°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,2,2,3,3-Hexafluoro-1-[(Trifluorovinyl)Oxy]Propane |