|
CAS#: 84254-87-5 Product: (E)-Cinnamyl 2-Methylisocrotonate No suppilers available for the product. |
| Name | (E)-Cinnamyl 2-Methylisocrotonate |
|---|---|
| Synonyms | (Z)-2-Methylbut-2-Enoic Acid [(E)-3-Phenylprop-2-Enyl] Ester; (E)-Cinnamyl 2-Methylisocrotonate |
| Molecular Structure | ![]() |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 |
| CAS Registry Number | 84254-87-5 |
| EINECS | 282-533-0 |
| SMILES | C1=C(\C=C\COC(C(=C/C)\C)=O)C=CC=C1 |
| InChI | 1S/C14H16O2/c1-3-12(2)14(15)16-11-7-10-13-8-5-4-6-9-13/h3-10H,11H2,1-2H3/b10-7+,12-3- |
| InChIKey | KRNURAJANZKGQN-QVSSJFJDSA-N |
| Density | 1.031g/cm3 (Cal.) |
|---|---|
| Boiling point | 340.478°C at 760 mmHg (Cal.) |
| Flash point | 198.161°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (E)-Cinnamyl 2-Methylisocrotonate |