|
CAS#: 84254-93-3 Product: 2,4-Dichloro-6-Methoxyanilinium Chloride No suppilers available for the product. |
| Name | 2,4-Dichloro-6-Methoxyanilinium Chloride |
|---|---|
| Synonyms | (2,4-Dichloro-6-Methoxy-Phenyl)Ammonium Chloride; (2,4-Dichloro-6-Methoxyphenyl)Ammonium Chloride; (2,4-Dichloro-6-Methoxy-Phenyl)Azanium Chloride |
| Molecular Structure | ![]() |
| Molecular Formula | C7H8Cl3NO |
| Molecular Weight | 228.51 |
| CAS Registry Number | 84254-93-3 |
| EINECS | 282-539-3 |
| SMILES | C1=C(Cl)C=C(OC)C(=C1Cl)[NH3+].[Cl-] |
| InChI | 1S/C7H7Cl2NO.ClH/c1-11-6-3-4(8)2-5(9)7(6)10;/h2-3H,10H2,1H3;1H |
| InChIKey | UPNRYPFDYAGGHH-UHFFFAOYSA-N |
| Boiling point | 273.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 119.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Dichloro-6-Methoxyanilinium Chloride |