|
CAS#: 84254-92-2 Product: 3',4'-Dihydroxy-2-(Isopropylamino)Butyrophenone No suppilers available for the product. |
| Name | 3',4'-Dihydroxy-2-(Isopropylamino)Butyrophenone |
|---|---|
| Synonyms | 1-(3,4-Dihydroxyphenyl)-2-(Isopropylamino)Butan-1-One; 3',4'-Dihydroxy-2-(Isopropylamino)Butyrophenone |
| Molecular Structure | ![]() |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 |
| CAS Registry Number | 84254-92-2 |
| EINECS | 282-538-8 |
| SMILES | C1=C(C(=O)C(NC(C)C)CC)C=CC(=C1O)O |
| InChI | 1S/C13H19NO3/c1-4-10(14-8(2)3)13(17)9-5-6-11(15)12(16)7-9/h5-8,10,14-16H,4H2,1-3H3 |
| InChIKey | NHSSSPKMGHYPKB-UHFFFAOYSA-N |
| Density | 1.13g/cm3 (Cal.) |
|---|---|
| Boiling point | 421.602°C at 760 mmHg (Cal.) |
| Flash point | 208.778°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3',4'-Dihydroxy-2-(Isopropylamino)Butyrophenone |