|
CAS#: 84255-44-7 Product: 2-(1,3-Diphenylbutyl)-p-Xylene No suppilers available for the product. |
| Name | 2-(1,3-Diphenylbutyl)-p-Xylene |
|---|---|
| Synonyms | 2-[1,3-Di(Phenyl)Butyl]-1,4-Dimethyl-Benzene; 2-(1,3-Diphenylbutyl)-P-Xylene |
| Molecular Structure | ![]() |
| Molecular Formula | C24H26 |
| Molecular Weight | 314.47 |
| CAS Registry Number | 84255-44-7 |
| EINECS | 282-593-8 |
| SMILES | C1=C(C=CC(=C1C(C2=CC=CC=C2)CC(C3=CC=CC=C3)C)C)C |
| InChI | 1S/C24H26/c1-18-14-15-19(2)23(16-18)24(22-12-8-5-9-13-22)17-20(3)21-10-6-4-7-11-21/h4-16,20,24H,17H2,1-3H3 |
| InChIKey | ABXLPLLAOXKDDO-UHFFFAOYSA-N |
| Density | 1.004g/cm3 (Cal.) |
|---|---|
| Boiling point | 416.639°C at 760 mmHg (Cal.) |
| Flash point | 204.118°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(1,3-Diphenylbutyl)-p-Xylene |