|
CAS#: 84255-47-0 Product: 2,5-Bis(1-Phenylethyl)-p-Xylene No suppilers available for the product. |
| Name | 2,5-Bis(1-Phenylethyl)-p-Xylene |
|---|---|
| Synonyms | 2,5-Bis(1-Phenylethyl)-P-Xylene |
| Molecular Structure | ![]() |
| Molecular Formula | C24H26 |
| Molecular Weight | 314.47 |
| CAS Registry Number | 84255-47-0 |
| EINECS | 282-596-4 |
| SMILES | C2=C(C(C1=CC=CC=C1)C)C(=CC(=C2C)C(C3=CC=CC=C3)C)C |
| InChI | 1S/C24H26/c1-17-15-24(20(4)22-13-9-6-10-14-22)18(2)16-23(17)19(3)21-11-7-5-8-12-21/h5-16,19-20H,1-4H3 |
| InChIKey | GWMNFJKPPXCNRA-UHFFFAOYSA-N |
| Density | 0.997g/cm3 (Cal.) |
|---|---|
| Boiling point | 427.374°C at 760 mmHg (Cal.) |
| Flash point | 210.528°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,5-Bis(1-Phenylethyl)-p-Xylene |