|
CAS#: 84255-49-2 Product: 4-Ethyl-1,2-Bis(1-Phenylethyl)Benzene No suppilers available for the product. |
| Name | 4-Ethyl-1,2-Bis(1-Phenylethyl)Benzene |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C24H26 |
| Molecular Weight | 314.47 |
| CAS Registry Number | 84255-49-2 |
| EINECS | 282-599-0 |
| SMILES | C1=C(CC)C=CC(=C1C(C2=CC=CC=C2)C)C(C3=CC=CC=C3)C |
| InChI | 1S/C24H26/c1-4-20-15-16-23(18(2)21-11-7-5-8-12-21)24(17-20)19(3)22-13-9-6-10-14-22/h5-19H,4H2,1-3H3 |
| InChIKey | HIWZLNTZYOZWBH-UHFFFAOYSA-N |
| Density | 0.996g/cm3 (Cal.) |
|---|---|
| Boiling point | 422.41°C at 760 mmHg (Cal.) |
| Flash point | 207.563°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Ethyl-1,2-Bis(1-Phenylethyl)Benzene |