|
CAS#: 84298-41-9 Product: 1,2,3,4-Tetrahydro-9-(2-(Dimethylamino)Ethyl)- 3-Methyl-9H-Pyrido[3,4-b]Indole No suppilers available for the product. |
| Name | 1,2,3,4-Tetrahydro-9-(2-(Dimethylamino)Ethyl)- 3-Methyl-9H-Pyrido[3,4-b]Indole |
|---|---|
| Synonyms | Dimethyl-[2-(3-Methyl-1,2,3,4-Tetrahydro-$B-Carbolin-9-Yl)Ethyl]Amine; 1,2,3,4-Tetrahydro-9-(2-(Dimethylamino)Ethyl)-3-Methyl-9H-Pyrido(3,4-B)Indole; 9H-Pyrido(3,4-B)Indole, 1,2,3,4-Tetrahydro-9-(2-(Dimethylamino)Ethyl)-3-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C16H23N3 |
| Molecular Weight | 257.38 |
| CAS Registry Number | 84298-41-9 |
| SMILES | C1=CC=CC2=C1C3=C([N]2CCN(C)C)CNC(C3)C |
| InChI | 1S/C16H23N3/c1-12-10-14-13-6-4-5-7-15(13)19(9-8-18(2)3)16(14)11-17-12/h4-7,12,17H,8-11H2,1-3H3 |
| InChIKey | VPDPQIQCIHLNHZ-UHFFFAOYSA-N |
| Density | 1.127g/cm3 (Cal.) |
|---|---|
| Boiling point | 411.297°C at 760 mmHg (Cal.) |
| Flash point | 202.545°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,4-Tetrahydro-9-(2-(Dimethylamino)Ethyl)- 3-Methyl-9H-Pyrido[3,4-b]Indole |