Online Database of Chemicals from Around the World
|
CAS#: 84434-70-8 Product: 3,3,5-Trimethylcyclohexyl 2-Aminobenzoate No suppilers available for the product. |
| Name | 3,3,5-Trimethylcyclohexyl 2-Aminobenzoate |
|---|---|
| Synonyms | 2-Aminobenzoic Acid (3,3,5-Trimethylcyclohexyl) Ester; 3,3,5-Trimethylcyclohexyl 2-Aminobenzoate |
| Molecular Structure |  |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 |
| CAS Registry Number | 84434-70-8 |
| EINECS | 282-871-9 |
| SMILES | C1=CC=CC(=C1N)C(OC2CC(CC(C2)C)(C)C)=O |
| InChI | 1S/C16H23NO2/c1-11-8-12(10-16(2,3)9-11)19-15(18)13-6-4-5-7-14(13)17/h4-7,11-12H,8-10,17H2,1-3H3 |
| InChIKey | ZZIOHIIUIJCJIW-UHFFFAOYSA-N |
| Density | 1.073g/cm3 (Cal.) |
|---|---|
| Boiling point | 363.278°C at 760 mmHg (Cal.) |
| Flash point | 205.482°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3,5-Trimethylcyclohexyl 2-Aminobenzoate |