|
CAS#: 84604-47-7 Product: 2-Methyl-1-(3,5,5-Trimethyl-2-Cyclohexen-1-Yl)Propan-1-One No suppilers available for the product. |
| Name | 2-Methyl-1-(3,5,5-Trimethyl-2-Cyclohexen-1-Yl)Propan-1-One |
|---|---|
| Synonyms | 2-Methyl-1-(3,5,5-Trimethyl-2-Cyclohexen-1-Yl)Propan-1-One |
| Molecular Structure | ![]() |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 |
| CAS Registry Number | 84604-47-7 |
| EINECS | 283-327-3 |
| SMILES | CC1(CC(C(=O)C(C)C)C=C(C1)C)C |
| InChI | 1S/C13H22O/c1-9(2)12(14)11-6-10(3)7-13(4,5)8-11/h6,9,11H,7-8H2,1-5H3 |
| InChIKey | WIAFBAKTXDPMOT-UHFFFAOYSA-N |
| Density | 0.88g/cm3 (Cal.) |
|---|---|
| Boiling point | 252.304°C at 760 mmHg (Cal.) |
| Flash point | 96.786°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-1-(3,5,5-Trimethyl-2-Cyclohexen-1-Yl)Propan-1-One |