|
CAS#: 84604-49-9 Product: 2-Methyl-1-(3,3,5-Trimethylcyclohexyl)Propan-1-One No suppilers available for the product. |
| Name | 2-Methyl-1-(3,3,5-Trimethylcyclohexyl)Propan-1-One |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C13H24O |
| Molecular Weight | 196.33 |
| CAS Registry Number | 84604-49-9 |
| EINECS | 283-329-4 |
| SMILES | CC1(CC(C(=O)C(C)C)CC(C1)C)C |
| InChI | 1S/C13H24O/c1-9(2)12(14)11-6-10(3)7-13(4,5)8-11/h9-11H,6-8H2,1-5H3 |
| InChIKey | GEHCZEBBRIVDOD-UHFFFAOYSA-N |
| Density | 0.855g/cm3 (Cal.) |
|---|---|
| Boiling point | 242.697°C at 760 mmHg (Cal.) |
| Flash point | 115.792°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-1-(3,3,5-Trimethylcyclohexyl)Propan-1-One |