|
CAS#: 84604-85-3 Product: 4-Bromo-2-(4-Nitrophenoxy)Phenol No suppilers available for the product. |
| Name | 4-Bromo-2-(4-Nitrophenoxy)Phenol |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C12H8BrNO4 |
| Molecular Weight | 310.10 |
| CAS Registry Number | 84604-85-3 |
| EINECS | 283-369-2 |
| SMILES | C1=C(Br)C=CC(=C1OC2=CC=C([N+]([O-])=O)C=C2)O |
| InChI | 1S/C12H8BrNO4/c13-8-1-6-11(15)12(7-8)18-10-4-2-9(3-5-10)14(16)17/h1-7,15H |
| InChIKey | YMBWRALKQKZRIV-UHFFFAOYSA-N |
| Density | 1.663g/cm3 (Cal.) |
|---|---|
| Boiling point | 382.646°C at 760 mmHg (Cal.) |
| Flash point | 185.218°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Bromo-2-(4-Nitrophenoxy)Phenol |