|
CAS#: 84604-84-2 Product: 4,5-Dibromo-2-(4-Nitrophenoxy)Phenol No suppilers available for the product. |
| Name | 4,5-Dibromo-2-(4-Nitrophenoxy)Phenol |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C12H7Br2NO4 |
| Molecular Weight | 389.00 |
| CAS Registry Number | 84604-84-2 |
| EINECS | 283-368-7 |
| SMILES | C1=C(Br)C(=CC(=C1OC2=CC=C([N+]([O-])=O)C=C2)O)Br |
| InChI | 1S/C12H7Br2NO4/c13-9-5-11(16)12(6-10(9)14)19-8-3-1-7(2-4-8)15(17)18/h1-6,16H |
| InChIKey | SOCIRCCLOXVPNG-UHFFFAOYSA-N |
| Density | 1.919g/cm3 (Cal.) |
|---|---|
| Boiling point | 420.572°C at 760 mmHg (Cal.) |
| Flash point | 208.155°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,5-Dibromo-2-(4-Nitrophenoxy)Phenol |