|
CAS#: 84962-64-1 Product: 4-Phenyl(Phenylmethyl)Phenol No suppilers available for the product. |
| Name | 4-Phenyl(Phenylmethyl)Phenol |
|---|---|
| Synonyms | 2-(Benzyl)-4-Phenyl-Phenol; 3-(Phenylmethyl)(1,1'-Biphenyl)-4-Ol |
| Molecular Structure | ![]() |
| Molecular Formula | C19H16O |
| Molecular Weight | 260.33 |
| CAS Registry Number | 84962-64-1 (21251-97-8) |
| EINECS | 244-295-6 |
| SMILES | C1=C(C=CC(=C1CC2=CC=CC=C2)O)C3=CC=CC=C3 |
| InChI | 1S/C19H16O/c20-19-12-11-17(16-9-5-2-6-10-16)14-18(19)13-15-7-3-1-4-8-15/h1-12,14,20H,13H2 |
| InChIKey | YZCWXIRNXBSTTB-UHFFFAOYSA-N |
| Density | 1.119g/cm3 (Cal.) |
|---|---|
| Boiling point | 410.64°C at 760 mmHg (Cal.) |
| Flash point | 195.181°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Phenyl(Phenylmethyl)Phenol |