|
CAS#: 85168-98-5 Product: Sodium (R)-2,3-Dimercaptopropanesulphonate No suppilers available for the product. |
| Name | Sodium (R)-2,3-Dimercaptopropanesulphonate |
|---|---|
| Synonyms | Sodium 2,3-Dimercaptopropane-1-Sulfonate; 2,3-Dimercaptopropanesulfonic Acid Sodium Salt; Dimaval |
| Molecular Structure | ![]() |
| Molecular Formula | C3H7NaO3S3 |
| Molecular Weight | 210.26 |
| CAS Registry Number | 85168-98-5 (85187-11-7) |
| EINECS | 285-941-7 |
| SMILES | C([S](=O)(=O)[O-])C(CS)S.[Na+] |
| InChI | 1S/C3H8O3S3.Na/c4-9(5,6)2-3(8)1-7;/h3,7-8H,1-2H2,(H,4,5,6);/q;+1/p-1 |
| InChIKey | FGGPAWQCCGEWTJ-UHFFFAOYSA-M |
| Melting point | 229°C (Expl.) |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Sodium (R)-2,3-Dimercaptopropanesulphonate |