|
CAS#: 85169-21-7 Product: 4-Ethoxy-2-Mercaptobenzamide No suppilers available for the product. |
| Name | 4-Ethoxy-2-Mercaptobenzamide |
|---|---|
| Synonyms | 4-Ethoxy-2-Sulfanyl-Benzamide; 4-Ethoxy-2-Mercaptobenzamide; 4-Ethoxy-2-Mercapto-Benzamide |
| Molecular Structure | ![]() |
| Molecular Formula | C9H11NO2S |
| Molecular Weight | 197.25 |
| CAS Registry Number | 85169-21-7 |
| EINECS | 285-963-7 |
| SMILES | C1=C(OCC)C=CC(=C1S)C(=O)N |
| InChI | 1S/C9H11NO2S/c1-2-12-6-3-4-7(9(10)11)8(13)5-6/h3-5,13H,2H2,1H3,(H2,10,11) |
| InChIKey | RWOSVQWVYSMNOG-UHFFFAOYSA-N |
| Density | 1.223g/cm3 (Cal.) |
|---|---|
| Boiling point | 336.261°C at 760 mmHg (Cal.) |
| Flash point | 157.165°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Ethoxy-2-Mercaptobenzamide |