|
CAS#: 85204-16-6 Product: 2-Ethyl-5,9-Dimethyldeca-2,4,8-Trienal No suppilers available for the product. |
| Name | 2-Ethyl-5,9-Dimethyldeca-2,4,8-Trienal |
|---|---|
| Synonyms | (2E,4E)-2-Ethyl-5,9-Dimethyl-Deca-2,4,8-Trienal; 2-Ethyl-5,9-Dimethyldeca-2,4,8-Trienal |
| Molecular Structure | ![]() |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 |
| CAS Registry Number | 85204-16-6 |
| EINECS | 286-310-9 |
| SMILES | C(\C(=C\C=C(C=O)/CC)C)CC=C(C)C |
| InChI | 1S/C14H22O/c1-5-14(11-15)10-9-13(4)8-6-7-12(2)3/h7,9-11H,5-6,8H2,1-4H3/b13-9+,14-10+ |
| InChIKey | CBCNSUNKJFIOKF-UTLPMFLDSA-N |
| Density | 0.87g/cm3 (Cal.) |
|---|---|
| Boiling point | 320.301°C at 760 mmHg (Cal.) |
| Flash point | 149.527°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Ethyl-5,9-Dimethyldeca-2,4,8-Trienal |