|
CAS#: 85304-06-9 Product: N-2-Propenylidene-9-Acridinamine No suppilers available for the product. |
| Name | N-2-Propenylidene-9-Acridinamine |
|---|---|
| Synonyms | N-(9-Acridinyl)Prop-2-En-1-Imine; Acridin-9-Yl-Allylidene-Amine; Ar7195000 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H12N2 |
| Molecular Weight | 232.28 |
| CAS Registry Number | 85304-06-9 |
| SMILES | C1=CC=CC2=NC3=C(C(=C12)N=CC=C)C=CC=C3 |
| InChI | 1S/C16H12N2/c1-2-11-17-16-12-7-3-5-9-14(12)18-15-10-6-4-8-13(15)16/h2-11H,1H2 |
| InChIKey | YGICOQMRFWUNNU-UHFFFAOYSA-N |
| Density | 1.09g/cm3 (Cal.) |
|---|---|
| Boiling point | 430.15°C at 760 mmHg (Cal.) |
| Flash point | 213.947°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-2-Propenylidene-9-Acridinamine |