|
CAS#: 85650-82-4 Product: 1-(2,2,4,4-Tetramethyl-3-pentanyl)naphthalene No suppilers available for the product. |
| Name | 1-(2,2,4,4-Tetramethyl-3-pentanyl)naphthalene |
|---|---|
| Synonyms | bis(1,1-dimethylethyl)methylnaphthalene |
| Molecular Structure | ![]() |
| Molecular Formula | C19H26 |
| Molecular Weight | 254.41 |
| CAS Registry Number | 85650-82-4 |
| EINECS | 288-092-0 |
| SMILES | c1cccc2cccc(c12)C(C(C)(C)C)C(C)(C)C |
| InChI | 1S/C19H26/c1-18(2,3)17(19(4,5)6)16-13-9-11-14-10-7-8-12-15(14)16/h7-13,17H,1-6H3 |
| InChIKey | WJVYWXDAHBLJIM-UHFFFAOYSA-N |
| Density | 0.933g/cm3 (Cal.) |
|---|---|
| Boiling point | 342.653°C at 760 mmHg (Cal.) |
| Flash point | 171.067°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2,2,4,4-Tetramethyl-3-pentanyl)naphthalene |