|
CAS#: 85665-59-4 Product: Methyl 1-(chlorocarbonyl)-L-prolinate No suppilers available for the product. |
| Name | Methyl 1-(chlorocarbonyl)-L-prolinate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C7H10ClNO3 |
| Molecular Weight | 191.61 |
| CAS Registry Number | 85665-59-4 |
| EINECS | 288-148-4 |
| SMILES | O=C(OC)[C@@H]1CCCN1C(=O)Cl |
| InChI | 1S/C7H10ClNO3/c1-12-6(10)5-3-2-4-9(5)7(8)11/h5H,2-4H2,1H3/t5-/m0/s1 |
| InChIKey | YUCJQEDFNSFKNN-YFKPBYRVSA-N |
| Density | 1.335g/cm3 (Cal.) |
|---|---|
| Boiling point | 287.502°C at 760 mmHg (Cal.) |
| Flash point | 127.677°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 1-(chlorocarbonyl)-L-prolinate |