|
CAS#: 85665-68-5 Product: Diethyl [2-(1-naphthylamino)ethyl]phosphonate No suppilers available for the product. |
| Name | Diethyl [2-(1-naphthylamino)ethyl]phosphonate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C16H22NO3P |
| Molecular Weight | 307.32 |
| CAS Registry Number | 85665-68-5 |
| EINECS | 288-158-9 |
| SMILES | O=P(OCC)(OCC)CCNc2cccc1ccccc12 |
| InChI | 1S/C16H22NO3P/c1-3-19-21(18,20-4-2)13-12-17-16-11-7-9-14-8-5-6-10-15(14)16/h5-11,17H,3-4,12-13H2,1-2H3 |
| InChIKey | TWRSIHFMRALFNP-UHFFFAOYSA-N |
| Density | 1.171g/cm3 (Cal.) |
|---|---|
| Boiling point | 471.302°C at 760 mmHg (Cal.) |
| Flash point | 238.835°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diethyl [2-(1-naphthylamino)ethyl]phosphonate |