|
CAS#: 85665-74-3 Product: 3-[(Diethylamino)(dimethyl)silyl]propyl methacrylate No suppilers available for the product. |
| Name | 3-[(Diethylamino)(dimethyl)silyl]propyl methacrylate |
|---|---|
| Synonyms | 3-[(diethylamino)dimethylsilyl]propyl methacrylate |
| Molecular Structure | ![]() |
| Molecular Formula | C13H27NO2Si |
| Molecular Weight | 257.44 |
| CAS Registry Number | 85665-74-3 |
| EINECS | 288-165-7 |
| SMILES | O=C(OCCC[Si](N(CC)CC)(C)C)\C(=C)C |
| InChI | 1S/C13H27NO2Si/c1-7-14(8-2)17(5,6)11-9-10-16-13(15)12(3)4/h3,7-11H2,1-2,4-6H3 |
| InChIKey | NCAKYDUZOGYDRH-UHFFFAOYSA-N |
| Density | 0.905g/cm3 (Cal.) |
|---|---|
| Boiling point | 300.699°C at 760 mmHg (Cal.) |
| Flash point | 135.658°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-[(Diethylamino)(dimethyl)silyl]propyl methacrylate |