Online Database of Chemicals from Around the World
|
CAS#: 85665-64-1 Product: 1,1,2,2,3,3,4,4,5,5,6,6,6-Tridecafluoro-N-(1-hydroxy-3-pentanyl)-1-hexanesulfonamide No suppilers available for the product. |
| Name | 1,1,2,2,3,3,4,4,5,5,6,6,6-Tridecafluoro-N-(1-hydroxy-3-pentanyl)-1-hexanesulfonamide |
|---|---|
| Synonyms | tridecafluoro-N-(2-hydroxyethyl)-N-propylhexanesulphonamide |
| Molecular Structure |  |
| Molecular Formula | C11H12F13NO3S |
| Molecular Weight | 485.26 |
| CAS Registry Number | 85665-64-1 |
| EINECS | 288-154-7 |
| SMILES | OCCC(NS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CC |
| InChI | 1S/C11H12F13NO3S/c1-2-5(3-4-26)25-29(27,28)11(23,24)9(18,19)7(14,15)6(12,13)8(16,17)10(20,21)22/h5,25-26H,2-4H2,1H3 |
| InChIKey | AIGLVVIUGQYLCN-UHFFFAOYSA-N |
| Density | 1.571g/cm3 (Cal.) |
|---|---|
| Boiling point | 318.106°C at 760 mmHg (Cal.) |
| Flash point | 146.185°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,2,2,3,3,4,4,5,5,6,6,6-Tridecafluoro-N-(1-hydroxy-3-pentanyl)-1-hexanesulfonamide |