|
CAS#: 85665-80-1 Product: (3E)-4-Phenyl-3-buten-2-yl 2-methylpropanoate No suppilers available for the product. |
| Name | (3E)-4-Phenyl-3-buten-2-yl 2-methylpropanoate |
|---|---|
| Synonyms | 1-methyl-3-phenylallyl isobutyrate |
| Molecular Structure | ![]() |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.29 |
| CAS Registry Number | 85665-80-1 |
| EINECS | 288-172-5 |
| SMILES | O=C(OC(/C=C/c1ccccc1)C)C(C)C |
| InChI | 1S/C14H18O2/c1-11(2)14(15)16-12(3)9-10-13-7-5-4-6-8-13/h4-12H,1-3H3/b10-9+ |
| InChIKey | BHCGJQKEBIOEQX-MDZDMXLPSA-N |
| Density | 1.005g/cm3 (Cal.) |
|---|---|
| Boiling point | 317.275°C at 760 mmHg (Cal.) |
| Flash point | 124.573°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3E)-4-Phenyl-3-buten-2-yl 2-methylpropanoate |