|
CAS#: 85720-79-2 Product: 2,3-Dichloro-1,1,1,2,3,4,5,5,5-nonafluoro-4-(trifluoromethyl)pentane No suppilers available for the product. |
| Name | 2,3-Dichloro-1,1,1,2,3,4,5,5,5-nonafluoro-4-(trifluoromethyl)pentane |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C6Cl2F12 |
| Molecular Weight | 370.95 |
| CAS Registry Number | 85720-79-2 |
| EINECS | 288-385-3 |
| SMILES | FC(Cl)(C(Cl)(F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | 1S/C6Cl2F12/c7-2(10,3(8,11)6(18,19)20)1(9,4(12,13)14)5(15,16)17 |
| InChIKey | DAKPRHAAVFWCOZ-UHFFFAOYSA-N |
| Density | 1.717g/cm3 (Cal.) |
|---|---|
| Boiling point | 109.25°C at 760 mmHg (Cal.) |
| Flash point | 40.702°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Dichloro-1,1,1,2,3,4,5,5,5-nonafluoro-4-(trifluoromethyl)pentane |