|
CAS#: 864685-32-5 Product: 3-(Difluoromethoxy)-N-(1,3-dioxolan-2-ylmethyl)-N-phenylbenzamide No suppilers available for the product. |
| Name | 3-(Difluoromethoxy)-N-(1,3-dioxolan-2-ylmethyl)-N-phenylbenzamide |
|---|---|
| Synonyms | BENZAMIDE |
| Molecular Structure | ![]() |
| Molecular Formula | C18H17F2NO4 |
| Molecular Weight | 349.33 |
| CAS Registry Number | 864685-32-5 |
| SMILES | O=C(N(CC1OCCO1)c2ccccc2)c3cccc(OC(F)F)c3 |
| InChI | 1S/C18H17F2NO4/c19-18(20)25-15-8-4-5-13(11-15)17(22)21(12-16-23-9-10-24-16)14-6-2-1-3-7-14/h1-8,11,16,18H,9-10,12H2 |
| InChIKey | VLCBXNZQDOFPNS-UHFFFAOYSA-N |
| Density | 1.299g/cm3 (Cal.) |
|---|---|
| Boiling point | 478.695°C at 760 mmHg (Cal.) |
| Flash point | 243.306°C (Cal.) |
| Refractive index | 1.564 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(Difluoromethoxy)-N-(1,3-dioxolan-2-ylmethyl)-N-phenylbenzamide |