| ChemICHIBA (Namiki Shoji Co., Ltd.) | Japan | Inquire | ||
|---|---|---|---|---|
![]() |
+81 (3) 3354-4030 | |||
![]() |
sales@chemichiba.com | |||
| Chemical manufacturer | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Name | {[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}(1-{7-[(2-methyl-2-propanyl)oxy]-7-oxoheptanoyl}-4-piperidinyl)acetic acid |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C33H42N2O7 |
| Molecular Weight | 578.70 |
| CAS Registry Number | 864685-37-0 |
| SMILES | O=C(CCCCCC(=O)OC(C)(C)C)N1CCC(CC1)C(NC(=O)OCC4c2ccccc2c3ccccc34)C(O)=O |
| InChI | 1S/C33H42N2O7/c1-33(2,3)42-29(37)16-6-4-5-15-28(36)35-19-17-22(18-20-35)30(31(38)39)34-32(40)41-21-27-25-13-9-7-11-23(25)24-12-8-10-14-26(24)27/h7-14,22,27,30H,4-6,15-21H2,1-3H3,(H,34,40)(H,38,39) |
| InChIKey | IJQIVBVQFVBADR-UHFFFAOYSA-N |
| Density | 1.204g/cm3 (Cal.) |
|---|---|
| Boiling point | 760.217°C at 760 mmHg (Cal.) |
| Flash point | 413.565°C (Cal.) |
| Refractive index | 1.564 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for {[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}(1-{7-[(2-methyl-2-propanyl)oxy]-7-oxoheptanoyl}-4-piperidinyl)acetic acid |