|
CAS#: 864754-36-9 Product: 1-[3-(4,4,5,5-Tetramethyl-[1,3,2]Dioxaborolan-2-Yl)-Phenyl]-2,5-Dihydro-1H-Pyrrole No suppilers available for the product. |
| Name | 1-[3-(4,4,5,5-Tetramethyl-[1,3,2]Dioxaborolan-2-Yl)-Phenyl]-2,5-Dihydro-1H-Pyrrole |
|---|---|
| Synonyms | Fs010818 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H22BNO2 |
| Molecular Weight | 271.17 |
| CAS Registry Number | 864754-36-9 |
| SMILES | C2=C(N1CC=CC1)C=CC=C2B3OC(C(O3)(C)C)(C)C |
| InChI | 1S/C16H22BNO2/c1-15(2)16(3,4)20-17(19-15)13-8-7-9-14(12-13)18-10-5-6-11-18/h5-9,12H,10-11H2,1-4H3 |
| InChIKey | KCDPVRJSPRGIDE-UHFFFAOYSA-N |
| Density | 1.08g/cm3 (Cal.) |
|---|---|
| Boiling point | 404.592°C at 760 mmHg (Cal.) |
| Flash point | 198.49°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[3-(4,4,5,5-Tetramethyl-[1,3,2]Dioxaborolan-2-Yl)-Phenyl]-2,5-Dihydro-1H-Pyrrole |