|
CAS#: 86797-92-4 Product: N-(2,6-Dimethylphenyl)-N-(2-hydroxyethyl)-2-piperidinecarboxamide No suppilers available for the product. |
| Name | N-(2,6-Dimethylphenyl)-N-(2-hydroxyethyl)-2-piperidinecarboxamide |
|---|---|
| Synonyms | droxicainide |
| Molecular Structure | ![]() |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.37 |
| CAS Registry Number | 86797-92-4 |
| SMILES | O=C(N(c1c(cccc1C)C)CCO)C2NCCCC2 |
| InChI | 1S/C16H24N2O2/c1-12-6-5-7-13(2)15(12)18(10-11-19)16(20)14-8-3-4-9-17-14/h5-7,14,17,19H,3-4,8-11H2,1-2H3 |
| InChIKey | ZQAWJFXTMQFNRX-UHFFFAOYSA-N |
| Density | 1.123g/cm3 (Cal.) |
|---|---|
| Boiling point | 464.242°C at 760 mmHg (Cal.) |
| Flash point | 234.566°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(2,6-Dimethylphenyl)-N-(2-hydroxyethyl)-2-piperidinecarboxamide |