|
CAS#: 86871-53-6 Product: (2R,3R)-2,3-Dihydroxysuccinic acid - 1-(2-{[5-(4-chlorophenyl)-1H-pyrazol-3-yl]oxy}ethyl)piperidine (1:1) No suppilers available for the product. |
| Name | (2R,3R)-2,3-Dihydroxysuccinic acid - 1-(2-{[5-(4-chlorophenyl)-1H-pyrazol-3-yl]oxy}ethyl)piperidine (1:1) |
|---|---|
| Synonyms | Piperidin |
| Molecular Structure | ![]() |
| Molecular Formula | C20H26ClN3O7 |
| Molecular Weight | 455.89 |
| CAS Registry Number | 86871-53-6 |
| SMILES | O=C(O)[C@H](O)[C@@H](O)C(=O)O.Clc1ccc(cc1)c3cc(OCCN2CCCCC2)nn3 |
| InChI | 1S/C16H20ClN3O.C4H6O6/c17-14-6-4-13(5-7-14)15-12-16(19-18-15)21-11-10-20-8-2-1-3-9-20;5-1(3(7)8)2(6)4(9)10/h4-7,12H,1-3,8-11H2,(H,18,19);1-2,5-6H,(H,7,8)(H,9,10)/t;1-,2-/m.1/s1 |
| InChIKey | QLHKUJICPCKELA-LREBCSMRSA-N |
| Boiling point | 501.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 256.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2R,3R)-2,3-Dihydroxysuccinic acid - 1-(2-{[5-(4-chlorophenyl)-1H-pyrazol-3-yl]oxy}ethyl)piperidine (1:1) |