|
CAS#: 87453-65-4 Product: 5-Methyl-8-quinolinol - 7-bromo-5-methyl-8-quinolinol (1:1) No suppilers available for the product. |
| Name | 5-Methyl-8-quinolinol - 7-bromo-5-methyl-8-quinolinol (1:1) |
|---|---|
| Synonyms | Intetrix |
| Molecular Structure | ![]() |
| Molecular Formula | C20H17BrN2O2 |
| Molecular Weight | 397.27 |
| CAS Registry Number | 87453-65-4 |
| SMILES | Brc1c(O)c2ncccc2c(c1)C.Oc2c1ncccc1c(cc2)C |
| InChI | 1S/C10H8BrNO.C10H9NO/c1-6-5-8(11)10(13)9-7(6)3-2-4-12-9;1-7-4-5-9(12)10-8(7)3-2-6-11-10/h2-5,13H,1H3;2-6,12H,1H3 |
| InChIKey | CIUVSYGSSMUTLH-UHFFFAOYSA-N |
| Boiling point | 342.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 160.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Methyl-8-quinolinol - 7-bromo-5-methyl-8-quinolinol (1:1) |