|
CAS#: 90243-98-4 Product: Dimoxaprost No suppilers available for the product. |
| Name | Dimoxaprost |
|---|---|
| Synonyms | (Z)-7-[(1S,2S,3S)-2-[(E,3S)-5-Ethoxy-3-Hydroxy-4,4-Dimethyl-Pent-1-Enyl]-3-Hydroxy-5-Oxo-Cyclopentyl]Hept-5-Enoic Acid; (Z)-7-[(1S,2S,3S)-2-[(E,3S)-5-Ethoxy-3-Hydroxy-4,4-Dimethyl-Pent-1-Enyl]-3-Hydroxy-5-Keto-Cyclopentyl]Hept-5-Enoic Acid; (Z)-7-((1Rs,2Rs, |
| Molecular Structure | ![]() |
| Molecular Formula | C21H34O6 |
| Molecular Weight | 382.50 |
| CAS Registry Number | 90243-98-4 |
| SMILES | [C@H]1(C(C[C@@H]([C@H]1\C=C\[C@@H](C(COCC)(C)C)O)O)=O)C\C=C/CCCC(=O)O |
| InChI | 1S/C21H34O6/c1-4-27-14-21(2,3)19(24)12-11-16-15(17(22)13-18(16)23)9-7-5-6-8-10-20(25)26/h5,7,11-12,15-16,18-19,23-24H,4,6,8-10,13-14H2,1-3H3,(H,25,26)/b7-5-,12-11+/t15-,16-,18-,19-/m0/s1 |
| InChIKey | UJFDLBWYYFZXDS-LEENOTDESA-N |
| Density | 1.16g/cm3 (Cal.) |
|---|---|
| Boiling point | 571.587°C at 760 mmHg (Cal.) |
| Flash point | 193.272°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dimoxaprost |