|
CAS#: 90605-12-2 Product: Ammonium isobutyl hydrogen phosphate No suppilers available for the product. |
| Name | Ammonium isobutyl hydrogen phosphate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C4H14NO4P |
| Molecular Weight | 171.13 |
| CAS Registry Number | 90605-12-2 |
| EINECS | 292-410-3 |
| SMILES | [NH4+].CC(C)COP([O-])(O)=O |
| InChI | 1S/C4H11O4P.H3N/c1-4(2)3-8-9(5,6)7;/h4H,3H2,1-2H3,(H2,5,6,7);1H3 |
| InChIKey | WGQZFFSTUCPLGV-UHFFFAOYSA-N |
| Boiling point | 322.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 148.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ammonium isobutyl hydrogen phosphate |