|
CAS#: 90889-39-7 Product: 2,5-Dichloro-8-methyl-9-thia-3,4,7-triazabicyclo[4.3.0]nona-2,4,7,10-tetraene No suppilers available for the product. |
| Name | 2,5-Dichloro-8-methyl-9-thia-3,4,7-triazabicyclo[4.3.0]nona-2,4,7,10-tetraene |
|---|---|
| Synonyms | 4,7-Dichloro-2-Methyl-Thiazolo[4,5-D]Pyridazine; 4,7-Dichloro-2-Methylthiazolo[4,5-D]Pyridazine; Nsc525318 |
| Molecular Structure | ![]() |
| Molecular Formula | C6H3Cl2N3S |
| Molecular Weight | 220.08 |
| CAS Registry Number | 90889-39-7 |
| SMILES | CC2=NC1=C(C(=NN=C1Cl)Cl)S2 |
| InChI | 1S/C6H3Cl2N3S/c1-2-9-3-4(12-2)6(8)11-10-5(3)7/h1H3 |
| InChIKey | TYFHPPFFFPVPBR-UHFFFAOYSA-N |
| Density | 1.656g/cm3 (Cal.) |
|---|---|
| Boiling point | 415.327°C at 760 mmHg (Cal.) |
| Flash point | 204.983°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,5-Dichloro-8-methyl-9-thia-3,4,7-triazabicyclo[4.3.0]nona-2,4,7,10-tetraene |