|
CAS#: 909659-43-4 Product: 4-(2-Pyridinylmethyl)-1-{[6-(trifluoromethyl)-3-pyridinyl]methyl}-1,4-diazepan-5-one No suppilers available for the product. |
| Name | 4-(2-Pyridinylmethyl)-1-{[6-(trifluoromethyl)-3-pyridinyl]methyl}-1,4-diazepan-5-one |
|---|---|
| Synonyms | 4-(pyridi |
| Molecular Structure | ![]() |
| Molecular Formula | C18H19F3N4O |
| Molecular Weight | 364.36 |
| CAS Registry Number | 909659-43-4 |
| SMILES | FC(F)(F)c3ccc(CN1CCC(=O)N(CC1)Cc2ccccn2)cn3 |
| InChI | 1S/C18H19F3N4O/c19-18(20,21)16-5-4-14(11-23-16)12-24-8-6-17(26)25(10-9-24)13-15-3-1-2-7-22-15/h1-5,7,11H,6,8-10,12-13H2 |
| InChIKey | WBDZZOWVZOVMPH-UHFFFAOYSA-N |
| Density | 1.304g/cm3 (Cal.) |
|---|---|
| Boiling point | 494.689°C at 760 mmHg (Cal.) |
| Flash point | 252.979°C (Cal.) |
| Refractive index | 1.556 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(2-Pyridinylmethyl)-1-{[6-(trifluoromethyl)-3-pyridinyl]methyl}-1,4-diazepan-5-one |