|
CAS#: 909666-31-5 Product: 1-[7-({[6-(Trifluoromethyl)-3-pyridinyl]methyl}amino)-2,3-dihydro-1H-indol-1-yl]ethanone No suppilers available for the product. |
| Name | 1-[7-({[6-(Trifluoromethyl)-3-pyridinyl]methyl}amino)-2,3-dihydro-1H-indol-1-yl]ethanone |
|---|---|
| Synonyms | 1-acetyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C17H16F3N3O |
| Molecular Weight | 335.32 |
| CAS Registry Number | 909666-31-5 |
| SMILES | FC(F)(F)c1ccc(cn1)CNc2cccc3CCN(c23)C(C)=O |
| InChI | 1S/C17H16F3N3O/c1-11(24)23-8-7-13-3-2-4-14(16(13)23)21-9-12-5-6-15(22-10-12)17(18,19)20/h2-6,10,21H,7-9H2,1H3 |
| InChIKey | KONVJSSRAMZADP-UHFFFAOYSA-N |
| Density | 1.354g/cm3 (Cal.) |
|---|---|
| Boiling point | 516.107°C at 760 mmHg (Cal.) |
| Flash point | 265.932°C (Cal.) |
| Refractive index | 1.591 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[7-({[6-(Trifluoromethyl)-3-pyridinyl]methyl}amino)-2,3-dihydro-1H-indol-1-yl]ethanone |