|
CAS#: 91147-50-1 Product: N-Pivaloylleucyl-gamma-Aminobutyric Acid No suppilers available for the product. |
| Name | N-Pivaloylleucyl-gamma-Aminobutyric Acid |
|---|---|
| Synonyms | 4-[[(2S)-2-(2,2-Dimethylpropanoylamino)-4-Methyl-Pentanoyl]Amino]Butanoic Acid; 4-[[(2S)-2-[(2,2-Dimethyl-1-Oxopropyl)Amino]-4-Methyl-1-Oxopentyl]Amino]Butanoic Acid; 4-[[(2S)-4-Methyl-2-(Pivaloylamino)Pentanoyl]Amino]Butyric Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C15H28N2O4 |
| Molecular Weight | 300.40 |
| CAS Registry Number | 91147-50-1 |
| SMILES | [C@@H](C(NCCCC(=O)O)=O)(CC(C)C)NC(C(C)(C)C)=O |
| InChI | 1S/C15H28N2O4/c1-10(2)9-11(17-14(21)15(3,4)5)13(20)16-8-6-7-12(18)19/h10-11H,6-9H2,1-5H3,(H,16,20)(H,17,21)(H,18,19)/t11-/m0/s1 |
| InChIKey | DXFCILWYVUYYQX-NSHDSACASA-N |
| Density | 1.06g/cm3 (Cal.) |
|---|---|
| Boiling point | 561.828°C at 760 mmHg (Cal.) |
| Flash point | 293.583°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Pivaloylleucyl-gamma-Aminobutyric Acid |