| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| RIA International LLC | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (973) 581-1282/ | |||
![]() |
marketing@riausa.net,nj@riausa.net | |||
| Chemical distributor | ||||
| Name | 2-Hydroxy-1,2-diphenylethanone |
|---|---|
| Synonyms | Benzoin (Jp15/Usp); Fenyl-Alpha-Hydroxybenzylketon [Czech]; Benjamin Gum |
| Molecular Structure | ![]() |
| Molecular Formula | C14H12O2 |
| Molecular Weight | 212.25 |
| CAS Registry Number | 91845-21-5 |
| SMILES | C1=CC=CC=C1C(C(C2=CC=CC=C2)=O)O |
| InChI | 1S/C14H12O2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13,15H |
| InChIKey | ISAOCJYIOMOJEB-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| 1.31 (Expl.) | |
| Melting point | 135°C (Expl.) |
| Boiling point | 194°C (Expl.) |
| 342.999°C at 760 mmHg (Cal.) | |
| Flash point | 154.8±14.9°C (Cal.) |
| 181°C (Expl.) | |
| Safety Description | Minimize exposure. |
|---|---|
| CAUTION: May irritate eyes, skin, and respiratory tract | |
| Market Analysis Reports |
| List of Reports Available for 2-Hydroxy-1,2-diphenylethanone |