|
CAS#: 919119-67-8 Product: Methyl 4-methoxy-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-2-carboxylate No suppilers available for the product. |
| Name | Methyl 4-methoxy-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-2-carboxylate |
|---|---|
| Synonyms | 1H-Indole |
| Molecular Structure | ![]() |
| Molecular Formula | C17H22BNO5 |
| Molecular Weight | 331.17 |
| CAS Registry Number | 919119-67-8 |
| SMILES | B1(OC(C(O1)(C)C)(C)C)c2ccc(c3c2[nH]c(c3)C(=O)OC)OC |
| InChI | 1S/C17H22BNO5/c1-16(2)17(3,4)24-18(23-16)11-7-8-13(21-5)10-9-12(15(20)22-6)19-14(10)11/h7-9,19H,1-6H3 |
| InChIKey | WVGFFXUFUVBSMJ-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 488.0±45.0°C at 760 mmHg (Cal.) |
| Flash point | 248.9±28.7°C (Cal.) |
| Refractive index | 1.555 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 4-methoxy-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-2-carboxylate |