|
CAS#: 92457-52-8 Product: 4',5'-Dimethylfluorescein Isothiocyanate No suppilers available for the product. |
| Name | 4',5'-Dimethylfluorescein Isothiocyanate |
|---|---|
| Synonyms | 3',6'-Dihydroxy-6-Isothiocyanato-4',5'-Dimethyl-Spiro[Isobenzofuran-3,9'-Xanthene]-1-One; 3',6'-Dihydroxy-6-Isothiocyanato-4',5'-Dimethyl-1-Spiro[Isobenzofuran-3,9'-Xanthene]One; 3',6'-Dihydroxy-6-Isothiocyanato-4',5'-Dimethyl-Spiro[2-Benzofuran-3,9'-Xanthe |
| Molecular Structure | ![]() |
| Molecular Formula | C23H15NO5S |
| Molecular Weight | 417.44 |
| CAS Registry Number | 92457-52-8 |
| SMILES | S=C=NC2=CC=C1C4(OC(=O)C1=C2)C3=CC=C(O)C(=C3OC5=C4C=CC(=C5C)O)C |
| InChI | 1S/C23H15NO5S/c1-11-18(25)7-5-16-20(11)28-21-12(2)19(26)8-6-17(21)23(16)15-4-3-13(24-10-30)9-14(15)22(27)29-23/h3-9,25-26H,1-2H3 |
| InChIKey | DXFGXFRWYRUSEO-UHFFFAOYSA-N |
| Density | 1.481g/cm3 (Cal.) |
|---|---|
| Boiling point | 691.907°C at 760 mmHg (Cal.) |
| Flash point | 372.252°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4',5'-Dimethylfluorescein Isothiocyanate |