|
CAS#: 93383-53-0 Product: (4,4,4-Trifluoro-2-oxobutyl) dihydrogen phosphate No suppilers available for the product. |
| Name | (4,4,4-Trifluoro-2-oxobutyl) dihydrogen phosphate |
|---|---|
| Synonyms | (4,4,4-Trifluoro-2-Oxo-Butyl) Dihydrogen Phosphate; (4,4,4-Trifluoro-2-Keto-Butyl) Dihydrogen Phosphate; 2-Keto-4,4,4-Trifluorobutyl Phosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C4H6F3O5P |
| Molecular Weight | 222.06 |
| CAS Registry Number | 93383-53-0 |
| SMILES | C(O[P](=O)(O)O)C(CC(F)(F)F)=O |
| InChI | 1S/C4H6F3O5P/c5-4(6,7)1-3(8)2-12-13(9,10)11/h1-2H2,(H2,9,10,11) |
| InChIKey | RMQHBNLAFHDMEN-UHFFFAOYSA-N |
| Density | 1.662g/cm3 (Cal.) |
|---|---|
| Boiling point | 299.466°C at 760 mmHg (Cal.) |
| Flash point | 134.912°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (4,4,4-Trifluoro-2-oxobutyl) dihydrogen phosphate |