|
CAS#: 93777-19-6 Product: Isopropenyl 2-methyl-4-oxo-8,8-diphenyl-3,7,9-trioxa-8-siladodec-1-en-12-oate No suppilers available for the product. |
| Name | Isopropenyl 2-methyl-4-oxo-8,8-diphenyl-3,7,9-trioxa-8-siladodec-1-en-12-oate |
|---|---|
| Synonyms | diisopropenyl 3,3'-[(diphenylsilylene)bis(oxy)]dipropionate |
| Molecular Structure | ![]() |
| Molecular Formula | C24H28O6Si |
| Molecular Weight | 440.56 |
| CAS Registry Number | 93777-19-6 |
| EINECS | 298-048-2 |
| SMILES | CC(=C)OC(=O)CCO[Si](OCCC(=O)OC(C)=C)(c1ccccc1)c2ccccc2 |
| InChI | 1S/C24H28O6Si/c1-19(2)29-23(25)15-17-27-31(21-11-7-5-8-12-21,22-13-9-6-10-14-22)28-18-16-24(26)30-20(3)4/h5-14H,1,3,15-18H2,2,4H3 |
| InChIKey | UOCNLWADXHUMPD-UHFFFAOYSA-N |
| Density | 1.131g/cm3 (Cal.) |
|---|---|
| Boiling point | 500.307°C at 760 mmHg (Cal.) |
| Flash point | 212.962°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Isopropenyl 2-methyl-4-oxo-8,8-diphenyl-3,7,9-trioxa-8-siladodec-1-en-12-oate |