|
CAS#: 93778-08-6 Product: 4-[2-Amino-5-(4-aminobenzyl)benzyl]-2,6-dimethylaniline No suppilers available for the product. |
| Name | 4-[2-Amino-5-(4-aminobenzyl)benzyl]-2,6-dimethylaniline |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C22H25N3 |
| Molecular Weight | 331.45 |
| CAS Registry Number | 93778-08-6 |
| EINECS | 298-141-8 |
| SMILES | Cc1cc(cc(c1N)C)Cc2cc(ccc2N)Cc3ccc(cc3)N |
| InChI | 1S/C22H25N3/c1-14-9-18(10-15(2)22(14)25)13-19-12-17(5-8-21(19)24)11-16-3-6-20(23)7-4-16/h3-10,12H,11,13,23-25H2,1-2H3 |
| InChIKey | RAGXBFXVDSLDBT-UHFFFAOYSA-N |
| Density | 1.152g/cm3 (Cal.) |
|---|---|
| Boiling point | 555.135°C at 760 mmHg (Cal.) |
| Flash point | 320.98°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[2-Amino-5-(4-aminobenzyl)benzyl]-2,6-dimethylaniline |