|
CAS#: 93840-76-7 Product: 4-(3-Methoxyprop-1-En-1-Yl)-1,3-Dimethylcyclohexene No suppilers available for the product. |
| Name | 4-(3-Methoxyprop-1-En-1-Yl)-1,3-Dimethylcyclohexene |
|---|---|
| Synonyms | 4-[(E)-3-Methoxyprop-1-Enyl]-1,3-Dimethyl-Cyclohexene; 4-(3-Methoxyprop-1-En-1-Yl)-1,3-Dimethylcyclohexene |
| Molecular Structure | ![]() |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 |
| CAS Registry Number | 93840-76-7 |
| EINECS | 298-942-2 |
| SMILES | C(OC)/C=C/C1C(C=C(CC1)C)C |
| InChI | 1S/C12H20O/c1-10-6-7-12(11(2)9-10)5-4-8-13-3/h4-5,9,11-12H,6-8H2,1-3H3/b5-4+ |
| InChIKey | HCRGRVZLFBLUGI-SNAWJCMRSA-N |
| Density | 0.918g/cm3 (Cal.) |
|---|---|
| Boiling point | 234.559°C at 760 mmHg (Cal.) |
| Flash point | 82.239°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(3-Methoxyprop-1-En-1-Yl)-1,3-Dimethylcyclohexene |