|
CAS#: 93842-82-1 Product: Ammonium 2-Sulphonatoethyl Undec-10-Enoate No suppilers available for the product. |
| Name | Ammonium 2-Sulphonatoethyl Undec-10-Enoate |
|---|---|
| Synonyms | Ammonium 2-Undec-10-Enoyloxyethanesulfonate; Ammonium 2-(1-Oxoundec-10-Enoxy)Ethanesulfonate |
| Molecular Structure | ![]() |
| Molecular Formula | C13H27NO5S |
| Molecular Weight | 309.42 |
| CAS Registry Number | 93842-82-1 |
| EINECS | 299-062-1 |
| SMILES | C(CCCCC=C)CCCC(OCC[S]([O-])(=O)=O)=O.[NH4+] |
| InChI | 1S/C13H24O5S.H3N/c1-2-3-4-5-6-7-8-9-10-13(14)18-11-12-19(15,16)17;/h2H,1,3-12H2,(H,15,16,17);1H3 |
| InChIKey | STZPOZYIRVHJJQ-UHFFFAOYSA-N |
| Boiling point | 474.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 240.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ammonium 2-Sulphonatoethyl Undec-10-Enoate |