|
CAS#: 93892-03-6 Product: (1S,2S,5S)-5-Isopropenyl-2-methylcyclohexyl butyrate No suppilers available for the product. |
| Name | (1S,2S,5S)-5-Isopropenyl-2-methylcyclohexyl butyrate |
|---|---|
| Synonyms | (1α,2β,5α)-2-methyl-5-(1-methylvinyl)cyclohexyl butyrate |
| Molecular Structure | ![]() |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 |
| CAS Registry Number | 93892-03-6 |
| EINECS | 299-483-0 |
| SMILES | O=C(O[C@H]1C[C@H](CC[C@@H]1C)C(C)=C)CCC |
| InChI | 1S/C14H24O2/c1-5-6-14(15)16-13-9-12(10(2)3)8-7-11(13)4/h11-13H,2,5-9H2,1,3-4H3/t11-,12-,13-/m0/s1 |
| InChIKey | AQCLKGPUNWCCQN-AVGNSLFASA-N |
| Density | 0.93g/cm3 (Cal.) |
|---|---|
| Boiling point | 279.158°C at 760 mmHg (Cal.) |
| Flash point | 114.745°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1S,2S,5S)-5-Isopropenyl-2-methylcyclohexyl butyrate |