Online Database of Chemicals from Around the World
|
CAS#: 93892-29-6 Product: 6-Sec-Butyl-2-Cyclopentylphenol No suppilers available for the product. |
| Name | 6-Sec-Butyl-2-Cyclopentylphenol |
|---|---|
| Synonyms | 2-Cyclopentyl-6-Sec-Butyl-Phenol; 2-Cyclopentyl-6-Sec-Butylphenol; 2-Butan-2-Yl-6-Cyclopentyl-Phenol |
| Molecular Structure |  |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 |
| CAS Registry Number | 93892-29-6 |
| EINECS | 299-511-1 |
| SMILES | C2=C(C(CC)C)C(=C(C1CCCC1)C=C2)O |
| InChI | 1S/C15H22O/c1-3-11(2)13-9-6-10-14(15(13)16)12-7-4-5-8-12/h6,9-12,16H,3-5,7-8H2,1-2H3 |
| InChIKey | BMHWAWBPZQGJIJ-UHFFFAOYSA-N |
| Density | 1.002g/cm3 (Cal.) |
|---|---|
| Boiling point | 272.803°C at 760 mmHg (Cal.) |
| Flash point | 125.069°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Sec-Butyl-2-Cyclopentylphenol |